C13H18F3NS — CID 116533990
4-methylsulfanyl-N-(6,6,6-trifluorohexan-2-yl)aniline (PubChem CID 116533990) has the molecular formula C13H18F3NS and a molecular weight of 277.36 g/mol. Its IUPAC name is 4-methylsulfanyl-N-(6,6,6-trifluorohexan-2-yl)aniline.
| Compound Name | 4-methylsulfanyl-N-(6,6,6-trifluorohexan-2-yl)aniline |
|---|---|
| PubChem CID | 116533990 |
| Molecular Formula | C13H18F3NS |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4-methylsulfanyl-N-(6,6,6-trifluorohexan-2-yl)aniline |
| SMILES | CSc1ccc(NC(C)CCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H18F3NS/c1-10(4-3-9-13(14,15)16)17-11-5-7-12(18-2)8-6-11/h5-8,10,17H,3-4,9H2,1-2H3 |
| InChIKey | RYCCWZQEBMVGMD-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |