C15H22F3NO2 — CID 116534427
3-ethoxy-4-methoxy-N-(6,6,6-trifluorohexan-2-yl)aniline (PubChem CID 116534427) has the molecular formula C15H22F3NO2 and a molecular weight of 305.34 g/mol. Its IUPAC name is 3-ethoxy-4-methoxy-N-(6,6,6-trifluorohexan-2-yl)aniline.
| Compound Name | 3-ethoxy-4-methoxy-N-(6,6,6-trifluorohexan-2-yl)aniline |
|---|---|
| PubChem CID | 116534427 |
| Molecular Formula | C15H22F3NO2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 3-ethoxy-4-methoxy-N-(6,6,6-trifluorohexan-2-yl)aniline |
| SMILES | CCOc1cc(NC(C)CCCC(F)(F)F)ccc1OC |
| InChI | InChI=1S/C15H22F3NO2/c1-4-21-14-10-12(7-8-13(14)20-3)19-11(2)6-5-9-15(16,17)18/h7-8,10-11,19H,4-6,9H2,1-3H3 |
| InChIKey | PDZJSUWSDCUCHG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|