C13H17BrF3NO — CID 116534966
4-bromo-3-methoxy-N-(6,6,6-trifluorohexan-2-yl)aniline (PubChem CID 116534966) has the molecular formula C13H17BrF3NO and a molecular weight of 340.18 g/mol. Its IUPAC name is 4-bromo-3-methoxy-N-(6,6,6-trifluorohexan-2-yl)aniline.
| Compound Name | 4-bromo-3-methoxy-N-(6,6,6-trifluorohexan-2-yl)aniline |
|---|---|
| PubChem CID | 116534966 |
| Molecular Formula | C13H17BrF3NO |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 4-bromo-3-methoxy-N-(6,6,6-trifluorohexan-2-yl)aniline |
| SMILES | COc1cc(NC(C)CCCC(F)(F)F)ccc1Br |
| InChI | InChI=1S/C13H17BrF3NO/c1-9(4-3-7-13(15,16)17)18-10-5-6-11(14)12(8-10)19-2/h5-6,8-9,18H,3-4,7H2,1-2H3 |
| InChIKey | ZOCUQXZVNJJCDL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |