C14H17F3N2 — CID 116534107
N-(6,6,6-trifluorohexan-2-yl)-1H-indol-5-amine (PubChem CID 116534107) has the molecular formula C14H17F3N2 and a molecular weight of 270.30 g/mol. Its IUPAC name is N-(6,6,6-trifluorohexan-2-yl)-1H-indol-5-amine.
| Compound Name | N-(6,6,6-trifluorohexan-2-yl)-1H-indol-5-amine |
|---|---|
| PubChem CID | 116534107 |
| Molecular Formula | C14H17F3N2 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | N-(6,6,6-trifluorohexan-2-yl)-1H-indol-5-amine |
| SMILES | CC(CCCC(F)(F)F)Nc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C14H17F3N2/c1-10(3-2-7-14(15,16)17)19-12-4-5-13-11(9-12)6-8-18-13/h4-6,8-10,18-19H,2-3,7H2,1H3 |
| InChIKey | UYSFPQKKDJSKIE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |