C13H17F4N — CID 116534048
3-fluoro-4-methyl-N-(6,6,6-trifluorohexan-2-yl)aniline (PubChem CID 116534048) has the molecular formula C13H17F4N and a molecular weight of 263.28 g/mol. Its IUPAC name is 3-fluoro-4-methyl-N-(6,6,6-trifluorohexan-2-yl)aniline.
| Compound Name | 3-fluoro-4-methyl-N-(6,6,6-trifluorohexan-2-yl)aniline |
|---|---|
| PubChem CID | 116534048 |
| Molecular Formula | C13H17F4N |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | 3-fluoro-4-methyl-N-(6,6,6-trifluorohexan-2-yl)aniline |
| SMILES | Cc1ccc(NC(C)CCCC(F)(F)F)cc1F |
| InChI | InChI=1S/C13H17F4N/c1-9-5-6-11(8-12(9)14)18-10(2)4-3-7-13(15,16)17/h5-6,8,10,18H,3-4,7H2,1-2H3 |
| InChIKey | KHKHNNCEGWOTRG-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |