C12H13BrF5N — CID 116534853
4-bromo-2,6-difluoro-N-(6,6,6-trifluorohexan-2-yl)aniline (PubChem CID 116534853) has the molecular formula C12H13BrF5N and a molecular weight of 346.14 g/mol. Its IUPAC name is 4-bromo-2,6-difluoro-N-(6,6,6-trifluorohexan-2-yl)aniline.
| Compound Name | 4-bromo-2,6-difluoro-N-(6,6,6-trifluorohexan-2-yl)aniline |
|---|---|
| PubChem CID | 116534853 |
| Molecular Formula | C12H13BrF5N |
| Molecular Weight | 346.14 g/mol |
| Exact Mass | 345.02 |
| IUPAC Name | 4-bromo-2,6-difluoro-N-(6,6,6-trifluorohexan-2-yl)aniline |
| SMILES | CC(CCCC(F)(F)F)Nc1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C12H13BrF5N/c1-7(3-2-4-12(16,17)18)19-11-9(14)5-8(13)6-10(11)15/h5-7,19H,2-4H2,1H3 |
| InChIKey | BMDURBVJLYICNV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.14 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |