C13H16Br2F3NO — CID 103412151
2,4-dibromo-5-methoxy-N-(6,6,6-trifluorohexan-2-yl)aniline (PubChem CID 103412151) has the molecular formula C13H16Br2F3NO and a molecular weight of 419.08 g/mol. Its IUPAC name is 2,4-dibromo-5-methoxy-N-(6,6,6-trifluorohexan-2-yl)aniline.
| Compound Name | 2,4-dibromo-5-methoxy-N-(6,6,6-trifluorohexan-2-yl)aniline |
|---|---|
| PubChem CID | 103412151 |
| Molecular Formula | C13H16Br2F3NO |
| Molecular Weight | 419.08 g/mol |
| Exact Mass | 416.96 |
| IUPAC Name | 2,4-dibromo-5-methoxy-N-(6,6,6-trifluorohexan-2-yl)aniline |
| SMILES | COc1cc(NC(C)CCCC(F)(F)F)c(Br)cc1Br |
| InChI | InChI=1S/C13H16Br2F3NO/c1-8(4-3-5-13(16,17)18)19-11-7-12(20-2)10(15)6-9(11)14/h6-8,19H,3-5H2,1-2H3 |
| InChIKey | AONSKFMBXZYMHG-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.08 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |