C11H14Br2N2O2 — CID 103413422
2-(2,4-dibromo-5-methoxyanilino)butanamide (PubChem CID 103413422) has the molecular formula C11H14Br2N2O2 and a molecular weight of 366.05 g/mol. Its IUPAC name is 2-(2,4-dibromo-5-methoxyanilino)butanamide.
| Compound Name | 2-(2,4-dibromo-5-methoxyanilino)butanamide |
|---|---|
| PubChem CID | 103413422 |
| Molecular Formula | C11H14Br2N2O2 |
| Molecular Weight | 366.05 g/mol |
| Exact Mass | 363.94 |
| IUPAC Name | 2-(2,4-dibromo-5-methoxyanilino)butanamide |
| SMILES | CCC(Nc1cc(OC)c(Br)cc1Br)C(N)=O |
| InChI | InChI=1S/C11H14Br2N2O2/c1-3-8(11(14)16)15-9-5-10(17-2)7(13)4-6(9)12/h4-5,8,15H,3H2,1-2H3,(H2,14,16) |
| InChIKey | GDLFXLCYDUNRIJ-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.05 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |