C11H12Br2N2O — CID 103412775
2-(2,4-dibromo-5-methoxyanilino)butanenitrile (PubChem CID 103412775) has the molecular formula C11H12Br2N2O and a molecular weight of 348.04 g/mol. Its IUPAC name is 2-(2,4-dibromo-5-methoxyanilino)butanenitrile.
| Compound Name | 2-(2,4-dibromo-5-methoxyanilino)butanenitrile |
|---|---|
| PubChem CID | 103412775 |
| Molecular Formula | C11H12Br2N2O |
| Molecular Weight | 348.04 g/mol |
| Exact Mass | 345.93 |
| IUPAC Name | 2-(2,4-dibromo-5-methoxyanilino)butanenitrile |
| SMILES | CCC(C#N)Nc1cc(OC)c(Br)cc1Br |
| InChI | InChI=1S/C11H12Br2N2O/c1-3-7(6-14)15-10-5-11(16-2)9(13)4-8(10)12/h4-5,7,15H,3H2,1-2H3 |
| InChIKey | XVVZEZDOZPWTOK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.04 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |