C15H15Br2NO — CID 103412044
2,4-dibromo-5-methoxy-N-(1-phenylethyl)aniline (PubChem CID 103412044) has the molecular formula C15H15Br2NO and a molecular weight of 385.10 g/mol. Its IUPAC name is 2,4-dibromo-5-methoxy-N-(1-phenylethyl)aniline.
| Compound Name | 2,4-dibromo-5-methoxy-N-(1-phenylethyl)aniline |
|---|---|
| PubChem CID | 103412044 |
| Molecular Formula | C15H15Br2NO |
| Molecular Weight | 385.10 g/mol |
| Exact Mass | 382.95 |
| IUPAC Name | 2,4-dibromo-5-methoxy-N-(1-phenylethyl)aniline |
| SMILES | COc1cc(NC(C)c2ccccc2)c(Br)cc1Br |
| InChI | InChI=1S/C15H15Br2NO/c1-10(11-6-4-3-5-7-11)18-14-9-15(19-2)13(17)8-12(14)16/h3-10,18H,1-2H3 |
| InChIKey | NHDQRDWHAASLPM-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.10 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |