C15H13Br2F2NO — CID 103411093
2,4-dibromo-N-[1-(3,4-difluorophenyl)ethyl]-5-methoxyaniline (PubChem CID 103411093) has the molecular formula C15H13Br2F2NO and a molecular weight of 421.08 g/mol. Its IUPAC name is 2,4-dibromo-N-[1-(3,4-difluorophenyl)ethyl]-5-methoxyaniline.
| Compound Name | 2,4-dibromo-N-[1-(3,4-difluorophenyl)ethyl]-5-methoxyaniline |
|---|---|
| PubChem CID | 103411093 |
| Molecular Formula | C15H13Br2F2NO |
| Molecular Weight | 421.08 g/mol |
| Exact Mass | 418.93 |
| IUPAC Name | 2,4-dibromo-N-[1-(3,4-difluorophenyl)ethyl]-5-methoxyaniline |
| SMILES | COc1cc(NC(C)c2ccc(F)c(F)c2)c(Br)cc1Br |
| InChI | InChI=1S/C15H13Br2F2NO/c1-8(9-3-4-12(18)13(19)5-9)20-14-7-15(21-2)11(17)6-10(14)16/h3-8,20H,1-2H3 |
| InChIKey | OLIFPAXBKVUABV-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.08 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |