C11H11Br2NO3 — CID 103414983
methyl (E)-3-(2,4-dibromo-5-methoxyanilino)prop-2-enoate (PubChem CID 103414983) has the molecular formula C11H11Br2NO3 and a molecular weight of 365.02 g/mol. Its IUPAC name is methyl (E)-3-(2,4-dibromo-5-methoxyanilino)prop-2-enoate.
| Compound Name | methyl (E)-3-(2,4-dibromo-5-methoxyanilino)prop-2-enoate |
|---|---|
| PubChem CID | 103414983 |
| Molecular Formula | C11H11Br2NO3 |
| Molecular Weight | 365.02 g/mol |
| Exact Mass | 362.91 |
| IUPAC Name | methyl (E)-3-(2,4-dibromo-5-methoxyanilino)prop-2-enoate |
| SMILES | COC(=O)/C=C/Nc1cc(OC)c(Br)cc1Br |
| InChI | InChI=1S/C11H11Br2NO3/c1-16-10-6-9(7(12)5-8(10)13)14-4-3-11(15)17-2/h3-6,14H,1-2H3/b4-3+ |
| InChIKey | AWBCXKFYEUFQMD-ONEGZZNKSA-N |
| XLogP | 3.32 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.02 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|