C13H13BrO5 — CID 58781559
methyl (E)-4-(2-bromo-4,5-dimethoxyphenyl)-4-oxobut-2-enoate (PubChem CID 58781559) has the molecular formula C13H13BrO5 and a molecular weight of 329.15 g/mol. Its IUPAC name is methyl (E)-4-(2-bromo-4,5-dimethoxyphenyl)-4-oxobut-2-enoate.
| Compound Name | methyl (E)-4-(2-bromo-4,5-dimethoxyphenyl)-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 58781559 |
| Molecular Formula | C13H13BrO5 |
| Molecular Weight | 329.15 g/mol |
| Exact Mass | 327.99 |
| IUPAC Name | methyl (E)-4-(2-bromo-4,5-dimethoxyphenyl)-4-oxobut-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)c1cc(OC)c(OC)cc1Br |
| InChI | InChI=1S/C13H13BrO5/c1-17-11-6-8(9(14)7-12(11)18-2)10(15)4-5-13(16)19-3/h4-7H,1-3H3/b5-4+ |
| InChIKey | ROCTTZKUMYAMJB-SNAWJCMRSA-N |
| XLogP | 2.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.15 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|