C12H11BrO5 — CID 64717125
(E)-4-(2-bromo-4,5-dimethoxyphenyl)-4-oxobut-2-enoic acid (PubChem CID 64717125) has the molecular formula C12H11BrO5 and a molecular weight of 315.12 g/mol. Its IUPAC name is (E)-4-(2-bromo-4,5-dimethoxyphenyl)-4-oxobut-2-enoic acid.
| Compound Name | (E)-4-(2-bromo-4,5-dimethoxyphenyl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 64717125 |
| Molecular Formula | C12H11BrO5 |
| Molecular Weight | 315.12 g/mol |
| Exact Mass | 313.98 |
| IUPAC Name | (E)-4-(2-bromo-4,5-dimethoxyphenyl)-4-oxobut-2-enoic acid |
| SMILES | COc1cc(Br)c(C(=O)/C=C/C(=O)O)cc1OC |
| InChI | InChI=1S/C12H11BrO5/c1-17-10-5-7(8(13)6-11(10)18-2)9(14)3-4-12(15)16/h3-6H,1-2H3,(H,15,16)/b4-3+ |
| InChIKey | LUZOQGDSUMVWAK-ONEGZZNKSA-N |
| XLogP | 2.29 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.12 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|