C18H12Br4O4 — CID 163912227
1-(2,5-dibromophenyl)ethanone;(E)-4-(2,5-dibromophenyl)-4-oxobut-2-enoic acid (PubChem CID 163912227) has the molecular formula C18H12Br4O4 and a molecular weight of 611.91 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)ethanone;(E)-4-(2,5-dibromophenyl)-4-oxobut-2-enoic acid.
| Compound Name | 1-(2,5-dibromophenyl)ethanone;(E)-4-(2,5-dibromophenyl)-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 163912227 |
| Molecular Formula | C18H12Br4O4 |
| Molecular Weight | 611.91 g/mol |
| Exact Mass | 607.75 |
| IUPAC Name | 1-(2,5-dibromophenyl)ethanone;(E)-4-(2,5-dibromophenyl)-4-oxobut-2-enoic acid |
| SMILES | CC(=O)c1cc(Br)ccc1Br.O=C(O)/C=C/C(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C10H6Br2O3.C8H6Br2O/c11-6-1-2-8(12)7(5-6)9(13)3-4-10(14)15;1-5(11)7-4-6(9)2-3-8(7)10/h1-5H,(H,14,15);2-4H,1H3/b4-3+; |
| InChIKey | QTCLAQGFHRQMQQ-BJILWQEISA-N |
| XLogP | 6.45 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.91 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|