C10H6Br2O4 — CID 75313125
4-(2,5-dibromophenyl)-4-hydroxy-2-oxobut-3-enoic acid (PubChem CID 75313125) has the molecular formula C10H6Br2O4 and a molecular weight of 349.96 g/mol. Its IUPAC name is 4-(2,5-dibromophenyl)-4-hydroxy-2-oxobut-3-enoic acid.
| Compound Name | 4-(2,5-dibromophenyl)-4-hydroxy-2-oxobut-3-enoic acid |
|---|---|
| PubChem CID | 75313125 |
| Molecular Formula | C10H6Br2O4 |
| Molecular Weight | 349.96 g/mol |
| Exact Mass | 347.86 |
| IUPAC Name | 4-(2,5-dibromophenyl)-4-hydroxy-2-oxobut-3-enoic acid |
| SMILES | O=C(O)C(=O)C=C(O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C10H6Br2O4/c11-5-1-2-7(12)6(3-5)8(13)4-9(14)10(15)16/h1-4,13H,(H,15,16) |
| InChIKey | UKCRALLBRMZJLT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.96 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|