C15H12Br2O — CID 114373318
1-(2,5-dibromophenyl)-2-(2-methylphenyl)ethanone (PubChem CID 114373318) has the molecular formula C15H12Br2O and a molecular weight of 368.07 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-2-(2-methylphenyl)ethanone.
| Compound Name | 1-(2,5-dibromophenyl)-2-(2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 114373318 |
| Molecular Formula | C15H12Br2O |
| Molecular Weight | 368.07 g/mol |
| Exact Mass | 365.93 |
| IUPAC Name | 1-(2,5-dibromophenyl)-2-(2-methylphenyl)ethanone |
| SMILES | Cc1ccccc1CC(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C15H12Br2O/c1-10-4-2-3-5-11(10)8-15(18)13-9-12(16)6-7-14(13)17/h2-7,9H,8H2,1H3 |
| InChIKey | UFTAFZWXYCNTTJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.07 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |