C14H9Br3O — CID 114019079
2-(2-bromophenyl)-1-(2,4-dibromophenyl)ethanone (PubChem CID 114019079) has the molecular formula C14H9Br3O and a molecular weight of 432.94 g/mol. Its IUPAC name is 2-(2-bromophenyl)-1-(2,4-dibromophenyl)ethanone.
| Compound Name | 2-(2-bromophenyl)-1-(2,4-dibromophenyl)ethanone |
|---|---|
| PubChem CID | 114019079 |
| Molecular Formula | C14H9Br3O |
| Molecular Weight | 432.94 g/mol |
| Exact Mass | 429.82 |
| IUPAC Name | 2-(2-bromophenyl)-1-(2,4-dibromophenyl)ethanone |
| SMILES | O=C(Cc1ccccc1Br)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H9Br3O/c15-10-5-6-11(13(17)8-10)14(18)7-9-3-1-2-4-12(9)16/h1-6,8H,7H2 |
| InChIKey | OQXRANCNBKNWNW-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.94 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |