C14H8BrF3O — CID 62963763
2-(2-bromophenyl)-1-(2,3,4-trifluorophenyl)ethanone (PubChem CID 62963763) has the molecular formula C14H8BrF3O and a molecular weight of 329.12 g/mol. Its IUPAC name is 2-(2-bromophenyl)-1-(2,3,4-trifluorophenyl)ethanone.
| Compound Name | 2-(2-bromophenyl)-1-(2,3,4-trifluorophenyl)ethanone |
|---|---|
| PubChem CID | 62963763 |
| Molecular Formula | C14H8BrF3O |
| Molecular Weight | 329.12 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | 2-(2-bromophenyl)-1-(2,3,4-trifluorophenyl)ethanone |
| SMILES | O=C(Cc1ccccc1Br)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H8BrF3O/c15-10-4-2-1-3-8(10)7-12(19)9-5-6-11(16)14(18)13(9)17/h1-6H,7H2 |
| InChIKey | VAEUARJDEPNYCD-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.12 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|