C14H7Br2F3O — CID 106267622
2-(3-bromo-2,6-difluorophenyl)-1-(3-bromo-2-fluorophenyl)ethanone (PubChem CID 106267622) has the molecular formula C14H7Br2F3O and a molecular weight of 408.01 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(3-bromo-2-fluorophenyl)ethanone.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(3-bromo-2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 106267622 |
| Molecular Formula | C14H7Br2F3O |
| Molecular Weight | 408.01 g/mol |
| Exact Mass | 405.88 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(3-bromo-2-fluorophenyl)ethanone |
| SMILES | O=C(Cc1c(F)ccc(Br)c1F)c1cccc(Br)c1F |
| InChI | InChI=1S/C14H7Br2F3O/c15-9-3-1-2-7(13(9)18)12(20)6-8-11(17)5-4-10(16)14(8)19/h1-5H,6H2 |
| InChIKey | STRHUZANADAFRZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.01 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|