C16H13BrF2O — CID 106267787
2-(3-bromo-2,6-difluorophenyl)-1-(2,3-dimethylphenyl)ethanone (PubChem CID 106267787) has the molecular formula C16H13BrF2O and a molecular weight of 339.18 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(2,3-dimethylphenyl)ethanone.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(2,3-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 106267787 |
| Molecular Formula | C16H13BrF2O |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(2,3-dimethylphenyl)ethanone |
| SMILES | Cc1cccc(C(=O)Cc2c(F)ccc(Br)c2F)c1C |
| InChI | InChI=1S/C16H13BrF2O/c1-9-4-3-5-11(10(9)2)15(20)8-12-14(18)7-6-13(17)16(12)19/h3-7H,8H2,1-2H3 |
| InChIKey | LVPRDWNPDHKDNU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|