C15H10BrClF2O2 — CID 106266339
2-(3-bromo-2,6-difluorophenyl)-1-(4-chloro-2-methoxyphenyl)ethanone (PubChem CID 106266339) has the molecular formula C15H10BrClF2O2 and a molecular weight of 375.60 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(4-chloro-2-methoxyphenyl)ethanone.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(4-chloro-2-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 106266339 |
| Molecular Formula | C15H10BrClF2O2 |
| Molecular Weight | 375.60 g/mol |
| Exact Mass | 373.95 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(4-chloro-2-methoxyphenyl)ethanone |
| SMILES | COc1cc(Cl)ccc1C(=O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C15H10BrClF2O2/c1-21-14-6-8(17)2-3-9(14)13(20)7-10-12(18)5-4-11(16)15(10)19/h2-6H,7H2,1H3 |
| InChIKey | QZQBITRMCMLUJN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|