C14H10BrF2NO2 — CID 106267638
2-(3-bromo-2,6-difluorophenyl)-1-(3-methoxy-4-pyridinyl)ethanone (PubChem CID 106267638) has the molecular formula C14H10BrF2NO2 and a molecular weight of 342.14 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(3-methoxy-4-pyridinyl)ethanone.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(3-methoxy-4-pyridinyl)ethanone |
|---|---|
| PubChem CID | 106267638 |
| Molecular Formula | C14H10BrF2NO2 |
| Molecular Weight | 342.14 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(3-methoxy-4-pyridinyl)ethanone |
| SMILES | COc1cnccc1C(=O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C14H10BrF2NO2/c1-20-13-7-18-5-4-8(13)12(19)6-9-11(16)3-2-10(15)14(9)17/h2-5,7H,6H2,1H3 |
| InChIKey | UTDHLKQCBYRRRE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.14 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|