C11H6BrF2NOS — CID 106266192
2-(3-bromo-2,6-difluorophenyl)-1-(1,3-thiazol-5-yl)ethanone (PubChem CID 106266192) has the molecular formula C11H6BrF2NOS and a molecular weight of 318.14 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(1,3-thiazol-5-yl)ethanone.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(1,3-thiazol-5-yl)ethanone |
|---|---|
| PubChem CID | 106266192 |
| Molecular Formula | C11H6BrF2NOS |
| Molecular Weight | 318.14 g/mol |
| Exact Mass | 316.93 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(1,3-thiazol-5-yl)ethanone |
| SMILES | O=C(Cc1c(F)ccc(Br)c1F)c1cncs1 |
| InChI | InChI=1S/C11H6BrF2NOS/c12-7-1-2-8(13)6(11(7)14)3-9(16)10-4-15-5-17-10/h1-2,4-5H,3H2 |
| InChIKey | GLOLVYDGVDTMTM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.14 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|