C9H5BrF2O3 — CID 130874083
3-(3-bromo-2,6-difluorophenyl)-2-oxopropanoic acid (PubChem CID 130874083) has the molecular formula C9H5BrF2O3 and a molecular weight of 279.04 g/mol. Its IUPAC name is 3-(3-bromo-2,6-difluorophenyl)-2-oxopropanoic acid.
| Compound Name | 3-(3-bromo-2,6-difluorophenyl)-2-oxopropanoic acid |
|---|---|
| PubChem CID | 130874083 |
| Molecular Formula | C9H5BrF2O3 |
| Molecular Weight | 279.04 g/mol |
| Exact Mass | 277.94 |
| IUPAC Name | 3-(3-bromo-2,6-difluorophenyl)-2-oxopropanoic acid |
| SMILES | O=C(O)C(=O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C9H5BrF2O3/c10-5-1-2-6(11)4(8(5)12)3-7(13)9(14)15/h1-2H,3H2,(H,14,15) |
| InChIKey | VSXJDWFWEQJAOA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.04 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|