C10H10BrF2NO — CID 106272492
1-(3-bromo-2,6-difluorophenyl)-3-(methylamino)propan-2-one (PubChem CID 106272492) has the molecular formula C10H10BrF2NO and a molecular weight of 278.10 g/mol. Its IUPAC name is 1-(3-bromo-2,6-difluorophenyl)-3-(methylamino)propan-2-one.
| Compound Name | 1-(3-bromo-2,6-difluorophenyl)-3-(methylamino)propan-2-one |
|---|---|
| PubChem CID | 106272492 |
| Molecular Formula | C10H10BrF2NO |
| Molecular Weight | 278.10 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | 1-(3-bromo-2,6-difluorophenyl)-3-(methylamino)propan-2-one |
| SMILES | CNCC(=O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C10H10BrF2NO/c1-14-5-6(15)4-7-9(12)3-2-8(11)10(7)13/h2-3,14H,4-5H2,1H3 |
| InChIKey | OSBDHJGYDDNRPV-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.10 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|