C11H12BrF2NO — CID 106272652
3-amino-1-(3-bromo-2,6-difluorophenyl)pentan-2-one (PubChem CID 106272652) has the molecular formula C11H12BrF2NO and a molecular weight of 292.12 g/mol. Its IUPAC name is 3-amino-1-(3-bromo-2,6-difluorophenyl)pentan-2-one.
| Compound Name | 3-amino-1-(3-bromo-2,6-difluorophenyl)pentan-2-one |
|---|---|
| PubChem CID | 106272652 |
| Molecular Formula | C11H12BrF2NO |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | 3-amino-1-(3-bromo-2,6-difluorophenyl)pentan-2-one |
| SMILES | CCC(N)C(=O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C11H12BrF2NO/c1-2-9(15)10(16)5-6-8(13)4-3-7(12)11(6)14/h3-4,9H,2,5,15H2,1H3 |
| InChIKey | VWHJZYGJSSXROX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|