C16H19BrF2O — CID 106266107
2-(3-bromo-2,6-difluorophenyl)-1-(4,4-dimethylcyclohexyl)ethanone (PubChem CID 106266107) has the molecular formula C16H19BrF2O and a molecular weight of 345.23 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(4,4-dimethylcyclohexyl)ethanone.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(4,4-dimethylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 106266107 |
| Molecular Formula | C16H19BrF2O |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(4,4-dimethylcyclohexyl)ethanone |
| SMILES | CC1(C)CCC(C(=O)Cc2c(F)ccc(Br)c2F)CC1 |
| InChI | InChI=1S/C16H19BrF2O/c1-16(2)7-5-10(6-8-16)14(20)9-11-13(18)4-3-12(17)15(11)19/h3-4,10H,5-9H2,1-2H3 |
| InChIKey | VTJVDJOIQZAXRM-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|