C13H13BrF2O3S — CID 106267858
2-(3-bromo-2,6-difluorophenyl)-1-(1,1-dioxothian-2-yl)ethanone (PubChem CID 106267858) has the molecular formula C13H13BrF2O3S and a molecular weight of 367.21 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(1,1-dioxothian-2-yl)ethanone.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(1,1-dioxothian-2-yl)ethanone |
|---|---|
| PubChem CID | 106267858 |
| Molecular Formula | C13H13BrF2O3S |
| Molecular Weight | 367.21 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(1,1-dioxothian-2-yl)ethanone |
| SMILES | O=C(Cc1c(F)ccc(Br)c1F)C1CCCCS1(=O)=O |
| InChI | InChI=1S/C13H13BrF2O3S/c14-9-4-5-10(15)8(13(9)16)7-11(17)12-3-1-2-6-20(12,18)19/h4-5,12H,1-3,6-7H2 |
| InChIKey | NZKHTUHAPLQMEX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|