C12H11BrF2O — CID 106266083
2-(3-bromo-2,6-difluorophenyl)-1-cyclobutylethanone (PubChem CID 106266083) has the molecular formula C12H11BrF2O and a molecular weight of 289.12 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-cyclobutylethanone.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-cyclobutylethanone |
|---|---|
| PubChem CID | 106266083 |
| Molecular Formula | C12H11BrF2O |
| Molecular Weight | 289.12 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-cyclobutylethanone |
| SMILES | O=C(Cc1c(F)ccc(Br)c1F)C1CCC1 |
| InChI | InChI=1S/C12H11BrF2O/c13-9-4-5-10(14)8(12(9)15)6-11(16)7-2-1-3-7/h4-5,7H,1-3,6H2 |
| InChIKey | VSOHIFAAGPHUSK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.12 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|