C14H15BrF2OS2 — CID 106266299
2-(3-bromo-2,6-difluorophenyl)-1-(5,6-dimethyl-1,4-dithian-2-yl)ethanone (PubChem CID 106266299) has the molecular formula C14H15BrF2OS2 and a molecular weight of 381.31 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(5,6-dimethyl-1,4-dithian-2-yl)ethanone.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(5,6-dimethyl-1,4-dithian-2-yl)ethanone |
|---|---|
| PubChem CID | 106266299 |
| Molecular Formula | C14H15BrF2OS2 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 379.97 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(5,6-dimethyl-1,4-dithian-2-yl)ethanone |
| SMILES | CC1SCC(C(=O)Cc2c(F)ccc(Br)c2F)SC1C |
| InChI | InChI=1S/C14H15BrF2OS2/c1-7-8(2)20-13(6-19-7)12(18)5-9-11(16)4-3-10(15)14(9)17/h3-4,7-8,13H,5-6H2,1-2H3 |
| InChIKey | DTLQQUWJQZVXSC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|