C8H6BrF2NO — CID 131036088
2-(3-bromo-2,6-difluorophenyl)acetamide (PubChem CID 131036088) has the molecular formula C8H6BrF2NO and a molecular weight of 250.04 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)acetamide.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 131036088 |
| Molecular Formula | C8H6BrF2NO |
| Molecular Weight | 250.04 g/mol |
| Exact Mass | 248.96 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)acetamide |
| SMILES | NC(=O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C8H6BrF2NO/c9-5-1-2-6(10)4(8(5)11)3-7(12)13/h1-2H,3H2,(H2,12,13) |
| InChIKey | PFFNSWADHVQRCY-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.04 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|