C13H14BrF2NOS — CID 114166030
2-(3-bromo-2,6-difluorophenyl)-1-(4-methylthiomorpholin-3-yl)ethanone (PubChem CID 114166030) has the molecular formula C13H14BrF2NOS and a molecular weight of 350.23 g/mol. Its IUPAC name is 2-(3-bromo-2,6-difluorophenyl)-1-(4-methylthiomorpholin-3-yl)ethanone.
| Compound Name | 2-(3-bromo-2,6-difluorophenyl)-1-(4-methylthiomorpholin-3-yl)ethanone |
|---|---|
| PubChem CID | 114166030 |
| Molecular Formula | C13H14BrF2NOS |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 2-(3-bromo-2,6-difluorophenyl)-1-(4-methylthiomorpholin-3-yl)ethanone |
| SMILES | CN1CCSCC1C(=O)Cc1c(F)ccc(Br)c1F |
| InChI | InChI=1S/C13H14BrF2NOS/c1-17-4-5-19-7-11(17)12(18)6-8-10(15)3-2-9(14)13(8)16/h2-3,11H,4-7H2,1H3 |
| InChIKey | VAJVKZMMAIZWLS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|