C13H15Cl2NOS — CID 103595311
2-(3,4-dichlorophenyl)-1-(4-methylthiomorpholin-3-yl)ethanone (PubChem CID 103595311) has the molecular formula C13H15Cl2NOS and a molecular weight of 304.24 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-(4-methylthiomorpholin-3-yl)ethanone.
| Compound Name | 2-(3,4-dichlorophenyl)-1-(4-methylthiomorpholin-3-yl)ethanone |
|---|---|
| PubChem CID | 103595311 |
| Molecular Formula | C13H15Cl2NOS |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-(4-methylthiomorpholin-3-yl)ethanone |
| SMILES | CN1CCSCC1C(=O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2NOS/c1-16-4-5-18-8-12(16)13(17)7-9-2-3-10(14)11(15)6-9/h2-3,6,12H,4-5,7-8H2,1H3 |
| InChIKey | WLNCCYSAVJXZOR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |