C10H12ClNOS2 — CID 107359505
(3-chlorothiophen-2-yl)-(4-methylthiomorpholin-3-yl)methanone (PubChem CID 107359505) has the molecular formula C10H12ClNOS2 and a molecular weight of 261.80 g/mol. Its IUPAC name is (3-chlorothiophen-2-yl)-(4-methylthiomorpholin-3-yl)methanone.
| Compound Name | (3-chlorothiophen-2-yl)-(4-methylthiomorpholin-3-yl)methanone |
|---|---|
| PubChem CID | 107359505 |
| Molecular Formula | C10H12ClNOS2 |
| Molecular Weight | 261.80 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | (3-chlorothiophen-2-yl)-(4-methylthiomorpholin-3-yl)methanone |
| SMILES | CN1CCSCC1C(=O)c1sccc1Cl |
| InChI | InChI=1S/C10H12ClNOS2/c1-12-3-5-14-6-8(12)9(13)10-7(11)2-4-15-10/h2,4,8H,3,5-6H2,1H3 |
| InChIKey | WFCFLYQEZYUJHW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.80 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |