C9H9ClOS2 — CID 115825950
(3-chlorothiophen-2-yl)-(thiolan-3-yl)methanone (PubChem CID 115825950) has the molecular formula C9H9ClOS2 and a molecular weight of 232.76 g/mol. Its IUPAC name is (3-chlorothiophen-2-yl)-(thiolan-3-yl)methanone.
| Compound Name | (3-chlorothiophen-2-yl)-(thiolan-3-yl)methanone |
|---|---|
| PubChem CID | 115825950 |
| Molecular Formula | C9H9ClOS2 |
| Molecular Weight | 232.76 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | (3-chlorothiophen-2-yl)-(thiolan-3-yl)methanone |
| SMILES | O=C(c1sccc1Cl)C1CCSC1 |
| InChI | InChI=1S/C9H9ClOS2/c10-7-2-4-13-9(7)8(11)6-1-3-12-5-6/h2,4,6H,1,3,5H2 |
| InChIKey | SJIPSFWGSGDALX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.76 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |