C10H12O2S2 — CID 114286702
(3-methoxythiophen-2-yl)-(thiolan-3-yl)methanone (PubChem CID 114286702) has the molecular formula C10H12O2S2 and a molecular weight of 228.34 g/mol. Its IUPAC name is (3-methoxythiophen-2-yl)-(thiolan-3-yl)methanone.
| Compound Name | (3-methoxythiophen-2-yl)-(thiolan-3-yl)methanone |
|---|---|
| PubChem CID | 114286702 |
| Molecular Formula | C10H12O2S2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.03 |
| IUPAC Name | (3-methoxythiophen-2-yl)-(thiolan-3-yl)methanone |
| SMILES | COc1ccsc1C(=O)C1CCSC1 |
| InChI | InChI=1S/C10H12O2S2/c1-12-8-3-5-14-10(8)9(11)7-2-4-13-6-7/h3,5,7H,2,4,6H2,1H3 |
| InChIKey | PLXFAYONKOOWSE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |