C11H14N2O3S — CID 105126328
(3,5-dimethoxypyrazin-2-yl)-(thiolan-3-yl)methanone (PubChem CID 105126328) has the molecular formula C11H14N2O3S and a molecular weight of 254.31 g/mol. Its IUPAC name is (3,5-dimethoxypyrazin-2-yl)-(thiolan-3-yl)methanone.
| Compound Name | (3,5-dimethoxypyrazin-2-yl)-(thiolan-3-yl)methanone |
|---|---|
| PubChem CID | 105126328 |
| Molecular Formula | C11H14N2O3S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | (3,5-dimethoxypyrazin-2-yl)-(thiolan-3-yl)methanone |
| SMILES | COc1cnc(C(=O)C2CCSC2)c(OC)n1 |
| InChI | InChI=1S/C11H14N2O3S/c1-15-8-5-12-9(11(13-8)16-2)10(14)7-3-4-17-6-7/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | OBEGUFYEGMGTFS-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |