C12H10FN3O3 — CID 113404104
(3,5-dimethoxypyrazin-2-yl)-(3-fluoro-2-pyridinyl)methanone (PubChem CID 113404104) has the molecular formula C12H10FN3O3 and a molecular weight of 263.23 g/mol. Its IUPAC name is (3,5-dimethoxypyrazin-2-yl)-(3-fluoro-2-pyridinyl)methanone.
| Compound Name | (3,5-dimethoxypyrazin-2-yl)-(3-fluoro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 113404104 |
| Molecular Formula | C12H10FN3O3 |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | (3,5-dimethoxypyrazin-2-yl)-(3-fluoro-2-pyridinyl)methanone |
| SMILES | COc1cnc(C(=O)c2ncccc2F)c(OC)n1 |
| InChI | InChI=1S/C12H10FN3O3/c1-18-8-6-15-10(12(16-8)19-2)11(17)9-7(13)4-3-5-14-9/h3-6H,1-2H3 |
| InChIKey | IFRCKTCYLQMCTJ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 74.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |