C16H18N2O3 — CID 105126439
1-(3,5-dimethoxypyrazin-2-yl)-4-phenylbutan-1-one (PubChem CID 105126439) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is 1-(3,5-dimethoxypyrazin-2-yl)-4-phenylbutan-1-one.
| Compound Name | 1-(3,5-dimethoxypyrazin-2-yl)-4-phenylbutan-1-one |
|---|---|
| PubChem CID | 105126439 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1-(3,5-dimethoxypyrazin-2-yl)-4-phenylbutan-1-one |
| SMILES | COc1cnc(C(=O)CCCc2ccccc2)c(OC)n1 |
| InChI | InChI=1S/C16H18N2O3/c1-20-14-11-17-15(16(18-14)21-2)13(19)10-6-9-12-7-4-3-5-8-12/h3-5,7-8,11H,6,9-10H2,1-2H3 |
| InChIKey | AMSKDHXYKWFRMF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |