C11H9IN2O3S — CID 115796298
(3,5-dimethoxypyrazin-2-yl)-(5-iodothiophen-3-yl)methanone (PubChem CID 115796298) has the molecular formula C11H9IN2O3S and a molecular weight of 376.18 g/mol. Its IUPAC name is (3,5-dimethoxypyrazin-2-yl)-(5-iodothiophen-3-yl)methanone.
| Compound Name | (3,5-dimethoxypyrazin-2-yl)-(5-iodothiophen-3-yl)methanone |
|---|---|
| PubChem CID | 115796298 |
| Molecular Formula | C11H9IN2O3S |
| Molecular Weight | 376.18 g/mol |
| Exact Mass | 375.94 |
| IUPAC Name | (3,5-dimethoxypyrazin-2-yl)-(5-iodothiophen-3-yl)methanone |
| SMILES | COc1cnc(C(=O)c2csc(I)c2)c(OC)n1 |
| InChI | InChI=1S/C11H9IN2O3S/c1-16-8-4-13-9(11(14-8)17-2)10(15)6-3-7(12)18-5-6/h3-5H,1-2H3 |
| InChIKey | KNPPMILLPVMTEP-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.18 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|