C11H9BrN2O3S — CID 105126339
(5-bromothiophen-3-yl)-(3,5-dimethoxypyrazin-2-yl)methanone (PubChem CID 105126339) has the molecular formula C11H9BrN2O3S and a molecular weight of 329.18 g/mol. Its IUPAC name is (5-bromothiophen-3-yl)-(3,5-dimethoxypyrazin-2-yl)methanone.
| Compound Name | (5-bromothiophen-3-yl)-(3,5-dimethoxypyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 105126339 |
| Molecular Formula | C11H9BrN2O3S |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | (5-bromothiophen-3-yl)-(3,5-dimethoxypyrazin-2-yl)methanone |
| SMILES | COc1cnc(C(=O)c2csc(Br)c2)c(OC)n1 |
| InChI | InChI=1S/C11H9BrN2O3S/c1-16-8-4-13-9(11(14-8)17-2)10(15)6-3-7(12)18-5-6/h3-5H,1-2H3 |
| InChIKey | LNHHGKXQUJMSSZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |