C12H16N2O4 — CID 115796270
(3,5-dimethoxypyrazin-2-yl)-(2-methyloxolan-3-yl)methanone (PubChem CID 115796270) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is (3,5-dimethoxypyrazin-2-yl)-(2-methyloxolan-3-yl)methanone.
| Compound Name | (3,5-dimethoxypyrazin-2-yl)-(2-methyloxolan-3-yl)methanone |
|---|---|
| PubChem CID | 115796270 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (3,5-dimethoxypyrazin-2-yl)-(2-methyloxolan-3-yl)methanone |
| SMILES | COc1cnc(C(=O)C2CCOC2C)c(OC)n1 |
| InChI | InChI=1S/C12H16N2O4/c1-7-8(4-5-18-7)11(15)10-12(17-3)14-9(16-2)6-13-10/h6-8H,4-5H2,1-3H3 |
| InChIKey | NEVKWQUCANJGAZ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |