C11H16N2O5 — CID 115830736
(3,5-dimethoxypyrazin-2-yl)-(1,4-dioxan-2-yl)methanol (PubChem CID 115830736) has the molecular formula C11H16N2O5 and a molecular weight of 256.26 g/mol. Its IUPAC name is (3,5-dimethoxypyrazin-2-yl)-(1,4-dioxan-2-yl)methanol.
| Compound Name | (3,5-dimethoxypyrazin-2-yl)-(1,4-dioxan-2-yl)methanol |
|---|---|
| PubChem CID | 115830736 |
| Molecular Formula | C11H16N2O5 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (3,5-dimethoxypyrazin-2-yl)-(1,4-dioxan-2-yl)methanol |
| SMILES | COc1cnc(C(O)C2COCCO2)c(OC)n1 |
| InChI | InChI=1S/C11H16N2O5/c1-15-8-5-12-9(11(13-8)16-2)10(14)7-6-17-3-4-18-7/h5,7,10,14H,3-4,6H2,1-2H3 |
| InChIKey | RXTJOJIYKMEULX-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 82.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |