C11H14N4O3 — CID 107978634
(3,5-dimethoxypyrazin-2-yl)-(1-methylimidazol-4-yl)methanol (PubChem CID 107978634) has the molecular formula C11H14N4O3 and a molecular weight of 250.26 g/mol. Its IUPAC name is (3,5-dimethoxypyrazin-2-yl)-(1-methylimidazol-4-yl)methanol.
| Compound Name | (3,5-dimethoxypyrazin-2-yl)-(1-methylimidazol-4-yl)methanol |
|---|---|
| PubChem CID | 107978634 |
| Molecular Formula | C11H14N4O3 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | (3,5-dimethoxypyrazin-2-yl)-(1-methylimidazol-4-yl)methanol |
| SMILES | COc1cnc(C(O)c2cn(C)cn2)c(OC)n1 |
| InChI | InChI=1S/C11H14N4O3/c1-15-5-7(13-6-15)10(16)9-11(18-3)14-8(17-2)4-12-9/h4-6,10,16H,1-3H3 |
| InChIKey | LRRASCHXYTZAEN-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |