C10H11N3O3S — CID 113404120
(3,5-dimethoxypyrazin-2-yl)-(1,3-thiazol-4-yl)methanol (PubChem CID 113404120) has the molecular formula C10H11N3O3S and a molecular weight of 253.28 g/mol. Its IUPAC name is (3,5-dimethoxypyrazin-2-yl)-(1,3-thiazol-4-yl)methanol.
| Compound Name | (3,5-dimethoxypyrazin-2-yl)-(1,3-thiazol-4-yl)methanol |
|---|---|
| PubChem CID | 113404120 |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | (3,5-dimethoxypyrazin-2-yl)-(1,3-thiazol-4-yl)methanol |
| SMILES | COc1cnc(C(O)c2cscn2)c(OC)n1 |
| InChI | InChI=1S/C10H11N3O3S/c1-15-7-3-11-8(10(13-7)16-2)9(14)6-4-17-5-12-6/h3-5,9,14H,1-2H3 |
| InChIKey | ZWFNHUAHTRZSMH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |