C8H11F2N3O2 — CID 103517039
1-(3,5-dimethoxypyrazin-2-yl)-2,2-difluoroethanamine (PubChem CID 103517039) has the molecular formula C8H11F2N3O2 and a molecular weight of 219.19 g/mol. Its IUPAC name is 1-(3,5-dimethoxypyrazin-2-yl)-2,2-difluoroethanamine.
| Compound Name | 1-(3,5-dimethoxypyrazin-2-yl)-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 103517039 |
| Molecular Formula | C8H11F2N3O2 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 1-(3,5-dimethoxypyrazin-2-yl)-2,2-difluoroethanamine |
| SMILES | COc1cnc(C(N)C(F)F)c(OC)n1 |
| InChI | InChI=1S/C8H11F2N3O2/c1-14-4-3-12-6(5(11)7(9)10)8(13-4)15-2/h3,5,7H,11H2,1-2H3 |
| InChIKey | JXWBYYIUZUOBGX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |