C13H12F3N3O2 — CID 105031257
(3,5-dimethoxypyrazin-2-yl)-(2,4,6-trifluorophenyl)methanamine (PubChem CID 105031257) has the molecular formula C13H12F3N3O2 and a molecular weight of 299.25 g/mol. Its IUPAC name is (3,5-dimethoxypyrazin-2-yl)-(2,4,6-trifluorophenyl)methanamine.
| Compound Name | (3,5-dimethoxypyrazin-2-yl)-(2,4,6-trifluorophenyl)methanamine |
|---|---|
| PubChem CID | 105031257 |
| Molecular Formula | C13H12F3N3O2 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (3,5-dimethoxypyrazin-2-yl)-(2,4,6-trifluorophenyl)methanamine |
| SMILES | COc1cnc(C(N)c2c(F)cc(F)cc2F)c(OC)n1 |
| InChI | InChI=1S/C13H12F3N3O2/c1-20-9-5-18-12(13(19-9)21-2)11(17)10-7(15)3-6(14)4-8(10)16/h3-5,11H,17H2,1-2H3 |
| InChIKey | PSFRMKCPJXSVTB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |