C11H19N3O3 — CID 107946647
1-(3,5-dimethoxypyrazin-2-yl)-2-propoxyethanamine (PubChem CID 107946647) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-(3,5-dimethoxypyrazin-2-yl)-2-propoxyethanamine.
| Compound Name | 1-(3,5-dimethoxypyrazin-2-yl)-2-propoxyethanamine |
|---|---|
| PubChem CID | 107946647 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 1-(3,5-dimethoxypyrazin-2-yl)-2-propoxyethanamine |
| SMILES | CCCOCC(N)c1ncc(OC)nc1OC |
| InChI | InChI=1S/C11H19N3O3/c1-4-5-17-7-8(12)10-11(16-3)14-9(15-2)6-13-10/h6,8H,4-5,7,12H2,1-3H3 |
| InChIKey | OYMNKRJJMRDBKC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 79.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|