C10H14Cl2N2O — CID 79780789
1-(3,5-dichloro-2-pyridinyl)-2-propoxyethanamine (PubChem CID 79780789) has the molecular formula C10H14Cl2N2O and a molecular weight of 249.14 g/mol. Its IUPAC name is 1-(3,5-dichloro-2-pyridinyl)-2-propoxyethanamine.
| Compound Name | 1-(3,5-dichloro-2-pyridinyl)-2-propoxyethanamine |
|---|---|
| PubChem CID | 79780789 |
| Molecular Formula | C10H14Cl2N2O |
| Molecular Weight | 249.14 g/mol |
| Exact Mass | 248.05 |
| IUPAC Name | 1-(3,5-dichloro-2-pyridinyl)-2-propoxyethanamine |
| SMILES | CCCOCC(N)c1ncc(Cl)cc1Cl |
| InChI | InChI=1S/C10H14Cl2N2O/c1-2-3-15-6-9(13)10-8(12)4-7(11)5-14-10/h4-5,9H,2-3,6,13H2,1H3 |
| InChIKey | SKIURYCLJRAXFR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.14 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|